C20H24N4O3S — CID 142276470
6-(4-ethyl-3-methylanilino)-3-[2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]ethyl]-1H-pyrimidine-2,4-dione (PubChem CID 142276470) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 6-(4-ethyl-3-methylanilino)-3-[2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]ethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(4-ethyl-3-methylanilino)-3-[2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]ethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142276470 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 6-(4-ethyl-3-methylanilino)-3-[2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]ethyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCc1ccc(Nc2cc(=O)n(CCSCc3cc(C)on3)c(=O)[nH]2)cc1C |
| InChI | InChI=1S/C20H24N4O3S/c1-4-15-5-6-16(9-13(15)2)21-18-11-19(25)24(20(26)22-18)7-8-28-12-17-10-14(3)27-23-17/h5-6,9-11,21H,4,7-8,12H2,1-3H3,(H,22,26) |
| InChIKey | WEVQWEHSIPESSH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|