About N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine
N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine (PubChem CID 142276746) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine |
| PubChem CID | 142276746 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine |
| SMILES | CCNCC1=NC=C(C)NC1 |
| InChI | InChI=1S/C8H15N3/c1-3-9-5-8-6-10-7(2)4-11-8/h4,9-10H,3,5-6H2,1-2H3 |
| InChIKey | IYGLDHUXEPXCIY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine?
The IUPAC name of N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine (CID 142276746) is N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine.
What is the SMILES notation for N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine?
The canonical SMILES for N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine is CCNCC1=NC=C(C)NC1.
What is the InChIKey of N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine?
The InChIKey is IYGLDHUXEPXCIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-3-9-5-8-6-10-7(2)4-11-8/h4,9-10H,3,5-6H2,1-2H3.
What are the key properties of N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine?
N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine has a molecular weight of 153.23 g/mol, XLogP of 0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-methyl-1,2-dihydropyrazin-3-yl)methyl]ethanamine is sourced from PubChem (CID 142276746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).