About (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile
(2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile (PubChem CID 142277662) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile.
Molecular Properties
| Compound Name | (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile |
| PubChem CID | 142277662 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile |
| SMILES | C=C(/C=C\C(C#N)=C(/C)O)N1CCOCC1 |
| InChI | InChI=1S/C12H16N2O2/c1-10(14-5-7-16-8-6-14)3-4-12(9-13)11(2)15/h3-4,15H,1,5-8H2,2H3/b4-3-,12-11- |
| InChIKey | PTLQXGSZJODAGA-JZOZGDTMSA-N |
| XLogP | 1.74 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile?
The IUPAC name of (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile (CID 142277662) is (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile.
What is the SMILES notation for (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile?
The canonical SMILES for (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile is C=C(/C=C\C(C#N)=C(/C)O)N1CCOCC1.
What is the InChIKey of (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile?
The InChIKey is PTLQXGSZJODAGA-JZOZGDTMSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-10(14-5-7-16-8-6-14)3-4-12(9-13)11(2)15/h3-4,15H,1,5-8H2,2H3/b4-3-,12-11-.
What are the key properties of (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile?
(2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile has a molecular weight of 220.27 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,3Z)-2-(1-hydroxyethylidene)-5-morpholin-4-ylhexa-3,5-dienenitrile is sourced from PubChem (CID 142277662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).