About 4,4-dimethylazepin-1-ium
4,4-dimethylazepin-1-ium (PubChem CID 142277804) has the molecular formula C8H12N+
and a molecular weight of 122.19 g/mol. Its IUPAC name is 4,4-dimethylazepin-1-ium.
Molecular Properties
| Compound Name | 4,4-dimethylazepin-1-ium |
| PubChem CID | 142277804 |
| Molecular Formula | C8H12N+ |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.10 |
| IUPAC Name | 4,4-dimethylazepin-1-ium |
| SMILES | CC1(C)C=CC=[NH+]C=C1 |
| InChI | InChI=1S/C8H11N/c1-8(2)4-3-6-9-7-5-8/h3-7H,1-2H3/p+1 |
| InChIKey | PULNFUUKJPBQLR-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4,4-dimethylazepin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethylazepin-1-ium?
The IUPAC name of 4,4-dimethylazepin-1-ium (CID 142277804) is 4,4-dimethylazepin-1-ium.
What is the SMILES notation for 4,4-dimethylazepin-1-ium?
The canonical SMILES for 4,4-dimethylazepin-1-ium is CC1(C)C=CC=[NH+]C=C1.
What is the InChIKey of 4,4-dimethylazepin-1-ium?
The InChIKey is PULNFUUKJPBQLR-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H11N/c1-8(2)4-3-6-9-7-5-8/h3-7H,1-2H3/p+1.
What are the key properties of 4,4-dimethylazepin-1-ium?
4,4-dimethylazepin-1-ium has a molecular weight of 122.19 g/mol, XLogP of 0.25, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethylazepin-1-ium is sourced from PubChem (CID 142277804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).