C23H29ClN6 — CID 142277901
(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methanamine;piperazine (PubChem CID 142277901) has the molecular formula C23H29ClN6 and a molecular weight of 424.98 g/mol. Its IUPAC name is (13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methanamine;piperazine.
| Compound Name | (13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methanamine;piperazine |
|---|---|
| PubChem CID | 142277901 |
| Molecular Formula | C23H29ClN6 |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methanamine;piperazine |
| SMILES | C1CNCCN1.Cn1cncc1C(N)C1=CC2=CC=CNC2Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H19ClN4.C4H10N2/c1-24-11-22-10-18(24)19(21)16-7-13-3-2-6-23-17(13)8-12-4-5-14(20)9-15(12)16;1-2-6-4-3-5-1/h2-7,9-11,17,19,23H,8,21H2,1H3;5-6H,1-4H2 |
| InChIKey | MIOGSTYXFXYBOP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |