C30H42ClN5O3 — CID 142277960
tert-butyl formate;13-chloro-10-[methoxy-(3-methylimidazol-4-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaene;1-methylpiperazine (PubChem CID 142277960) has the molecular formula C30H42ClN5O3 and a molecular weight of 556.15 g/mol. Its IUPAC name is tert-butyl formate;13-chloro-10-[methoxy-(3-methylimidazol-4-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaene;1-methylpiperazine.
| Compound Name | tert-butyl formate;13-chloro-10-[methoxy-(3-methylimidazol-4-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaene;1-methylpiperazine |
|---|---|
| PubChem CID | 142277960 |
| Molecular Formula | C30H42ClN5O3 |
| Molecular Weight | 556.15 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | tert-butyl formate;13-chloro-10-[methoxy-(3-methylimidazol-4-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaene;1-methylpiperazine |
| SMILES | CC(C)(C)OC=O.CN1CCNCC1.COC(C1=CC2=CC=CNC2Cc2ccc(Cl)cc21)c1cncn1C |
| InChI | InChI=1S/C20H20ClN3O.C5H12N2.C5H10O2/c1-24-12-22-11-19(24)20(25-2)17-8-14-4-3-7-23-18(14)9-13-5-6-15(21)10-16(13)17;1-7-4-2-6-3-5-7;1-5(2,3)7-4-6/h3-8,10-12,18,20,23H,9H2,1-2H3;6H,2-5H2,1H3;4H,1-3H3 |
| InChIKey | JMFGTUXDLSIMGG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.15 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|