C16H15Cl2NO — CID 142278146
6,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one;ethane (PubChem CID 142278146) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is 6,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one;ethane.
| Compound Name | 6,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one;ethane |
|---|---|
| PubChem CID | 142278146 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 6,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one;ethane |
| SMILES | CC.O=C1c2ccc(Cl)cc2CCc2cc(Cl)cnc21 |
| InChI | InChI=1S/C14H9Cl2NO.C2H6/c15-10-3-4-12-8(5-10)1-2-9-6-11(16)7-17-13(9)14(12)18;1-2/h3-7H,1-2H2;1-2H3 |
| InChIKey | QUQKPDNEOMDEDR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |