C29H37ClN6O2 — CID 142278205
acetylene;(R)-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methanamine;propan-2-yl piperazine-1-carboxylate (PubChem CID 142278205) has the molecular formula C29H37ClN6O2 and a molecular weight of 537.11 g/mol. Its IUPAC name is acetylene;(R)-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methanamine;propan-2-yl piperazine-1-carboxylate.
| Compound Name | acetylene;(R)-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methanamine;propan-2-yl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142278205 |
| Molecular Formula | C29H37ClN6O2 |
| Molecular Weight | 537.11 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | acetylene;(R)-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methanamine;propan-2-yl piperazine-1-carboxylate |
| SMILES | C#C.CC(C)OC(=O)N1CCNCC1.Cn1cncc1[C@H](N)C1=CC2=CC=CNC2Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H19ClN4.C8H16N2O2.C2H2/c1-24-11-22-10-18(24)19(21)16-7-13-3-2-6-23-17(13)8-12-4-5-14(20)9-15(12)16;1-7(2)12-8(11)10-5-3-9-4-6-10;1-2/h2-7,9-11,17,19,23H,8,21H2,1H3;7,9H,3-6H2,1-2H3;1-2H/t17?,19-;;/m1../s1 |
| InChIKey | KHJQKLJGRSRXGY-XCURNFNKSA-N |
| XLogP | 3.81 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.11 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|