C18H17NO — CID 142278226
13-methyl-10-(2-methyloxiran-2-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 142278226) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 13-methyl-10-(2-methyloxiran-2-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | 13-methyl-10-(2-methyloxiran-2-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 142278226 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 13-methyl-10-(2-methyloxiran-2-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | Cc1ccc2c(c1)C(C1(C)CO1)=Cc1cccnc1C2 |
| InChI | InChI=1S/C18H17NO/c1-12-5-6-13-10-17-14(4-3-7-19-17)9-16(15(13)8-12)18(2)11-20-18/h3-9H,10-11H2,1-2H3 |
| InChIKey | ISPNRTQZOMTSJA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|