C24H23N4O10+ — CID 142278413
[4-[3,5-bis(carboxymethyliminomethyl)-4-hydroxyphenyl]-2,6-bis(carboxymethyliminomethyl)phenyl]oxidanium (PubChem CID 142278413) has the molecular formula C24H23N4O10+ and a molecular weight of 527.47 g/mol. Its IUPAC name is [4-[3,5-bis(carboxymethyliminomethyl)-4-hydroxyphenyl]-2,6-bis(carboxymethyliminomethyl)phenyl]oxidanium.
| Compound Name | [4-[3,5-bis(carboxymethyliminomethyl)-4-hydroxyphenyl]-2,6-bis(carboxymethyliminomethyl)phenyl]oxidanium |
|---|---|
| PubChem CID | 142278413 |
| Molecular Formula | C24H23N4O10+ |
| Molecular Weight | 527.47 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | [4-[3,5-bis(carboxymethyliminomethyl)-4-hydroxyphenyl]-2,6-bis(carboxymethyliminomethyl)phenyl]oxidanium |
| SMILES | O=C(O)C/N=C/c1cc(-c2cc(/C=N/CC(=O)O)c([OH2+])c(/C=N/CC(=O)O)c2)cc(/C=N/CC(=O)O)c1O |
| InChI | InChI=1S/C24H22N4O10/c29-19(30)9-25-5-15-1-13(2-16(23(15)37)6-26-10-20(31)32)14-3-17(7-27-11-21(33)34)24(38)18(4-14)8-28-12-22(35)36/h1-8,37-38H,9-12H2,(H,29,30)(H,31,32)(H,33,34)(H,35,36)/p+1/b25-5+,26-6+,27-7+,28-8+ |
| InChIKey | TYRAULPMWJNIKS-VWEDYSTHSA-O |
| XLogP | 0.51 |
| TPSA | 241.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.47 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|