About 3-amino-6-methylphenanthrene-9,10-dione;ethane
3-amino-6-methylphenanthrene-9,10-dione;ethane (PubChem CID 142278417) has the molecular formula C17H17NO2
and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-amino-6-methylphenanthrene-9,10-dione;ethane.
Molecular Properties
| Compound Name | 3-amino-6-methylphenanthrene-9,10-dione;ethane |
| PubChem CID | 142278417 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-amino-6-methylphenanthrene-9,10-dione;ethane |
| SMILES | CC.Cc1ccc2c(c1)-c1cc(N)ccc1C(=O)C2=O |
| InChI | InChI=1S/C15H11NO2.C2H6/c1-8-2-4-10-12(6-8)13-7-9(16)3-5-11(13)15(18)14(10)17;1-2/h2-7H,16H2,1H3;1-2H3 |
| InChIKey | WOFGASWBJMARMA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-6-methylphenanthrene-9,10-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-methylphenanthrene-9,10-dione;ethane?
The IUPAC name of 3-amino-6-methylphenanthrene-9,10-dione;ethane (CID 142278417) is 3-amino-6-methylphenanthrene-9,10-dione;ethane.
What is the SMILES notation for 3-amino-6-methylphenanthrene-9,10-dione;ethane?
The canonical SMILES for 3-amino-6-methylphenanthrene-9,10-dione;ethane is CC.Cc1ccc2c(c1)-c1cc(N)ccc1C(=O)C2=O.
What is the InChIKey of 3-amino-6-methylphenanthrene-9,10-dione;ethane?
The InChIKey is WOFGASWBJMARMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO2.C2H6/c1-8-2-4-10-12(6-8)13-7-9(16)3-5-11(13)15(18)14(10)17;1-2/h2-7H,16H2,1H3;1-2H3.
What are the key properties of 3-amino-6-methylphenanthrene-9,10-dione;ethane?
3-amino-6-methylphenanthrene-9,10-dione;ethane has a molecular weight of 267.33 g/mol, XLogP of 3.65, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-methylphenanthrene-9,10-dione;ethane is sourced from PubChem (CID 142278417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).