C41H50N2O7 — CID 14227908
4-[4-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]oxyanilino]-4-oxobutanoic acid (PubChem CID 14227908) has the molecular formula C41H50N2O7 and a molecular weight of 682.86 g/mol. Its IUPAC name is 4-[4-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]oxyanilino]-4-oxobutanoic acid.
| Compound Name | 4-[4-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]oxyanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 14227908 |
| Molecular Formula | C41H50N2O7 |
| Molecular Weight | 682.86 g/mol |
| Exact Mass | 682.36 |
| IUPAC Name | 4-[4-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]oxyanilino]-4-oxobutanoic acid |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(Oc3ccc(NC(=O)CCC(=O)O)cc3)c3ccccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C41H50N2O7/c1-7-40(3,4)27-15-20-34(33(25-27)41(5,6)8-2)49-24-12-11-23-42-39(48)32-26-35(30-13-9-10-14-31(30)38(32)47)50-29-18-16-28(17-19-29)43-36(44)21-22-37(45)46/h9-10,13-20,25-26,47H,7-8,11-12,21-24H2,1-6H3,(H,42,48)(H,43,44)(H,45,46) |
| InChIKey | HYAYLMCCVRCGED-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.86 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|