About 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine
4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine (PubChem CID 142279313) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine.
Molecular Properties
| Compound Name | 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine |
| PubChem CID | 142279313 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine |
| SMILES | C=CC1=C(C=C)COCC1.CN |
| InChI | InChI=1S/C9H12O.CH5N/c1-3-8-5-6-10-7-9(8)4-2;1-2/h3-4H,1-2,5-7H2;2H2,1H3 |
| InChIKey | AXQCMBRFSIWBMJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine?
The IUPAC name of 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine (CID 142279313) is 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine.
What is the SMILES notation for 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine?
The canonical SMILES for 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine is C=CC1=C(C=C)COCC1.CN.
What is the InChIKey of 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine?
The InChIKey is AXQCMBRFSIWBMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.CH5N/c1-3-8-5-6-10-7-9(8)4-2;1-2/h3-4H,1-2,5-7H2;2H2,1H3.
What are the key properties of 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine?
4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine has a molecular weight of 167.25 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethenyl)-3,6-dihydro-2H-pyran;methanamine is sourced from PubChem (CID 142279313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).