About 3,4-dihydro-1H-isochromene;ethane;methanamine
3,4-dihydro-1H-isochromene;ethane;methanamine (PubChem CID 142279347) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 3,4-dihydro-1H-isochromene;ethane;methanamine.
Molecular Properties
| Compound Name | 3,4-dihydro-1H-isochromene;ethane;methanamine |
| PubChem CID | 142279347 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 3,4-dihydro-1H-isochromene;ethane;methanamine |
| SMILES | CC.CC.CN.c1ccc2c(c1)CCOC2 |
| InChI | InChI=1S/C9H10O.2C2H6.CH5N/c1-2-4-9-7-10-6-5-8(9)3-1;3*1-2/h1-4H,5-7H2;2*1-2H3;2H2,1H3 |
| InChIKey | GLEOCATWTFTKSP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydro-1H-isochromene;ethane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-1H-isochromene;ethane;methanamine?
The IUPAC name of 3,4-dihydro-1H-isochromene;ethane;methanamine (CID 142279347) is 3,4-dihydro-1H-isochromene;ethane;methanamine.
What is the SMILES notation for 3,4-dihydro-1H-isochromene;ethane;methanamine?
The canonical SMILES for 3,4-dihydro-1H-isochromene;ethane;methanamine is CC.CC.CN.c1ccc2c(c1)CCOC2.
What is the InChIKey of 3,4-dihydro-1H-isochromene;ethane;methanamine?
The InChIKey is GLEOCATWTFTKSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.2C2H6.CH5N/c1-2-4-9-7-10-6-5-8(9)3-1;3*1-2/h1-4H,5-7H2;2*1-2H3;2H2,1H3.
What are the key properties of 3,4-dihydro-1H-isochromene;ethane;methanamine?
3,4-dihydro-1H-isochromene;ethane;methanamine has a molecular weight of 225.38 g/mol, XLogP of 3.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-1H-isochromene;ethane;methanamine is sourced from PubChem (CID 142279347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).