About 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine
8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine (PubChem CID 142279492) has the molecular formula C11H16FNO2
and a molecular weight of 213.25 g/mol. Its IUPAC name is 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine.
Molecular Properties
| Compound Name | 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine |
| PubChem CID | 142279492 |
| Molecular Formula | C11H16FNO2 |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine |
| SMILES | CNC.OC1COCc2c(F)cccc21 |
| InChI | InChI=1S/C9H9FO2.C2H7N/c10-8-3-1-2-6-7(8)4-12-5-9(6)11;1-3-2/h1-3,9,11H,4-5H2;3H,1-2H3 |
| InChIKey | CPYUCWWWCNLIQO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine?
The IUPAC name of 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine (CID 142279492) is 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine.
What is the SMILES notation for 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine?
The canonical SMILES for 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine is CNC.OC1COCc2c(F)cccc21.
What is the InChIKey of 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine?
The InChIKey is CPYUCWWWCNLIQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO2.C2H7N/c10-8-3-1-2-6-7(8)4-12-5-9(6)11;1-3-2/h1-3,9,11H,4-5H2;3H,1-2H3.
What are the key properties of 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine?
8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine has a molecular weight of 213.25 g/mol, XLogP of 1.22, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-3,4-dihydro-1H-isochromen-4-ol;N-methylmethanamine is sourced from PubChem (CID 142279492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).