About [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile
[[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile (PubChem CID 142279500) has the molecular formula C11H9BBrF2NO3
and a molecular weight of 331.91 g/mol. Its IUPAC name is [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile.
Molecular Properties
| Compound Name | [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile |
| PubChem CID | 142279500 |
| Molecular Formula | C11H9BBrF2NO3 |
| Molecular Weight | 331.91 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile |
| SMILES | CB(C#N)CC(O)c1c(Br)ccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C11H9BBrF2NO3/c1-12(5-16)4-7(17)9-6(13)2-3-8-10(9)19-11(14,15)18-8/h2-3,7,17H,4H2,1H3 |
| InChIKey | UVGYWORFZRCZBE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.91 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile?
The IUPAC name of [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile (CID 142279500) is [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile.
What is the SMILES notation for [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile?
The canonical SMILES for [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile is CB(C#N)CC(O)c1c(Br)ccc2c1OC(F)(F)O2.
What is the InChIKey of [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile?
The InChIKey is UVGYWORFZRCZBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BBrF2NO3/c1-12(5-16)4-7(17)9-6(13)2-3-8-10(9)19-11(14,15)18-8/h2-3,7,17H,4H2,1H3.
What are the key properties of [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile?
[[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile has a molecular weight of 331.91 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(5-bromo-2,2-difluoro-1,3-benzodioxol-4-yl)-2-hydroxyethyl]-methylboranyl]formonitrile is sourced from PubChem (CID 142279500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).