C20H33BF2O2 — CID 142279602
2-[2-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 142279602) has the molecular formula C20H33BF2O2 and a molecular weight of 354.29 g/mol. Its IUPAC name is 2-[2-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 142279602 |
| Molecular Formula | C20H33BF2O2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 2-[2-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1CC2CC(C)CC(C(CB3OC(C)(C)C(C)(C)O3)=C(F)F)(C1)C2 |
| InChI | InChI=1S/C20H33BF2O2/c1-13-7-15-8-14(2)10-20(9-13,11-15)16(17(22)23)12-21-24-18(3,4)19(5,6)25-21/h13-15H,7-12H2,1-6H3 |
| InChIKey | HXRQUWOHGGEOBE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|