C30H36FN3O — CID 142279688
ethane;N-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]formamide;3-methyl-4-phenyl-1H-pyrrole (PubChem CID 142279688) has the molecular formula C30H36FN3O and a molecular weight of 473.64 g/mol. Its IUPAC name is ethane;N-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]formamide;3-methyl-4-phenyl-1H-pyrrole.
| Compound Name | ethane;N-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]formamide;3-methyl-4-phenyl-1H-pyrrole |
|---|---|
| PubChem CID | 142279688 |
| Molecular Formula | C30H36FN3O |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | ethane;N-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]formamide;3-methyl-4-phenyl-1H-pyrrole |
| SMILES | CC.Cc1c[nH]cc1-c1ccccc1.O=CNCC1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C17H19FN2O.C11H11N.C2H6/c18-14-5-6-17-16(9-14)15(7-8-20-17)13-3-1-12(2-4-13)10-19-11-21;1-9-7-12-8-11(9)10-5-3-2-4-6-10;1-2/h5-9,11-13H,1-4,10H2,(H,19,21);2-8,12H,1H3;1-2H3 |
| InChIKey | NFLPIXWRGUKSOG-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|