About 2,4-dimethylpenta-1,4-dien-3-imine
2,4-dimethylpenta-1,4-dien-3-imine (PubChem CID 142280306) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is 2,4-dimethylpenta-1,4-dien-3-imine.
Molecular Properties
| Compound Name | 2,4-dimethylpenta-1,4-dien-3-imine |
| PubChem CID | 142280306 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 2,4-dimethylpenta-1,4-dien-3-imine |
| SMILES | [H]N=C(C(=C)C)C(=C)C |
| InChI | InChI=1S/C7H11N/c1-5(2)7(8)6(3)4/h8H,1,3H2,2,4H3 |
| InChIKey | QJFFQFCXCXGEIQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylpenta-1,4-dien-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpenta-1,4-dien-3-imine?
The IUPAC name of 2,4-dimethylpenta-1,4-dien-3-imine (CID 142280306) is 2,4-dimethylpenta-1,4-dien-3-imine.
What is the SMILES notation for 2,4-dimethylpenta-1,4-dien-3-imine?
The canonical SMILES for 2,4-dimethylpenta-1,4-dien-3-imine is [H]N=C(C(=C)C)C(=C)C.
What is the InChIKey of 2,4-dimethylpenta-1,4-dien-3-imine?
The InChIKey is QJFFQFCXCXGEIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N/c1-5(2)7(8)6(3)4/h8H,1,3H2,2,4H3.
What are the key properties of 2,4-dimethylpenta-1,4-dien-3-imine?
2,4-dimethylpenta-1,4-dien-3-imine has a molecular weight of 109.17 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpenta-1,4-dien-3-imine is sourced from PubChem (CID 142280306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).