C34H50N2OP2 — CID 14228078
(2S,4S)-N-tert-butyl-4-dicyclohexylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxamide (PubChem CID 14228078) has the molecular formula C34H50N2OP2 and a molecular weight of 564.74 g/mol. Its IUPAC name is (2S,4S)-N-tert-butyl-4-dicyclohexylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S,4S)-N-tert-butyl-4-dicyclohexylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 14228078 |
| Molecular Formula | C34H50N2OP2 |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | (2S,4S)-N-tert-butyl-4-dicyclohexylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1C[C@@H](P(C2CCCCC2)C2CCCCC2)C[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H50N2OP2/c1-34(2,3)35-33(37)36-25-32(39(30-20-12-6-13-21-30)31-22-14-7-15-23-31)24-27(36)26-38(28-16-8-4-9-17-28)29-18-10-5-11-19-29/h4-5,8-11,16-19,27,30-32H,6-7,12-15,20-26H2,1-3H3,(H,35,37)/t27-,32-/m0/s1 |
| InChIKey | FPWZGUCKEVRHJT-UCGGBYDDSA-N |
| XLogP | 8.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|