C12H21F3N2O3 — CID 142280974
2-amino-N-cyclohexyl-2-methylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 142280974) has the molecular formula C12H21F3N2O3 and a molecular weight of 298.31 g/mol. Its IUPAC name is 2-amino-N-cyclohexyl-2-methylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-amino-N-cyclohexyl-2-methylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 142280974 |
| Molecular Formula | C12H21F3N2O3 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-amino-N-cyclohexyl-2-methylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(N)C(=O)NC1CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H20N2O.C2HF3O2/c1-10(2,11)9(13)12-8-6-4-3-5-7-8;3-2(4,5)1(6)7/h8H,3-7,11H2,1-2H3,(H,12,13);(H,6,7) |
| InChIKey | FQWLHBAGFCRZFX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |