C6H18O4Si4 — CID 14228108
2,2,4,4,6,6-Hexamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (PubChem CID 14228108) has the molecular formula C6H18O4Si4 and a molecular weight of 266.55 g/mol.
| Compound Name | 2,2,4,4,6,6-Hexamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane |
|---|---|
| PubChem CID | 14228108 |
| Molecular Formula | C6H18O4Si4 |
| Molecular Weight | 266.55 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | — |
| SMILES | C[Si]1(C)O[Si]O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C6H18O4Si4/c1-12(2)7-11-8-13(3,4)10-14(5,6)9-12/h1-6H3 |
| InChIKey | OMXZEFFNFXSEPA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.55 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|