C33H40O2 — CID 142281111
1-[[3,5-bis(methoxymethyl)phenyl]-[3,5-bis(prop-2-enyl)phenyl]methyl]-3,5-diethylbenzene (PubChem CID 142281111) has the molecular formula C33H40O2 and a molecular weight of 468.68 g/mol. Its IUPAC name is 1-[[3,5-bis(methoxymethyl)phenyl]-[3,5-bis(prop-2-enyl)phenyl]methyl]-3,5-diethylbenzene.
| Compound Name | 1-[[3,5-bis(methoxymethyl)phenyl]-[3,5-bis(prop-2-enyl)phenyl]methyl]-3,5-diethylbenzene |
|---|---|
| PubChem CID | 142281111 |
| Molecular Formula | C33H40O2 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 1-[[3,5-bis(methoxymethyl)phenyl]-[3,5-bis(prop-2-enyl)phenyl]methyl]-3,5-diethylbenzene |
| SMILES | C=CCc1cc(CC=C)cc(C(c2cc(CC)cc(CC)c2)c2cc(COC)cc(COC)c2)c1 |
| InChI | InChI=1S/C33H40O2/c1-7-11-26-14-27(12-8-2)19-31(18-26)33(30-16-24(9-3)13-25(10-4)17-30)32-20-28(22-34-5)15-29(21-32)23-35-6/h7-8,13-21,33H,1-2,9-12,22-23H2,3-6H3 |
| InChIKey | ODKMXTZGKNFLIS-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|