About ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate
ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate (PubChem CID 142281132) has the molecular formula C20H22O2
and a molecular weight of 294.39 g/mol. Its IUPAC name is ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate |
| PubChem CID | 142281132 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate |
| SMILES | C=Cc1cc2ccc(C)cc2c(CCC(=O)OCC)c1C=C |
| InChI | InChI=1S/C20H22O2/c1-5-15-13-16-9-8-14(4)12-19(16)18(17(15)6-2)10-11-20(21)22-7-3/h5-6,8-9,12-13H,1-2,7,10-11H2,3-4H3 |
| InChIKey | QTFPDEGUXBEVRU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate?
The IUPAC name of ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate (CID 142281132) is ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate.
What is the SMILES notation for ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate?
The canonical SMILES for ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate is C=Cc1cc2ccc(C)cc2c(CCC(=O)OCC)c1C=C.
What is the InChIKey of ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate?
The InChIKey is QTFPDEGUXBEVRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O2/c1-5-15-13-16-9-8-14(4)12-19(16)18(17(15)6-2)10-11-20(21)22-7-3/h5-6,8-9,12-13H,1-2,7,10-11H2,3-4H3.
What are the key properties of ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate?
ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate has a molecular weight of 294.39 g/mol, XLogP of 4.93, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2,3-bis(ethenyl)-7-methylnaphthalen-1-yl]propanoate is sourced from PubChem (CID 142281132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).