About ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate
ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate (PubChem CID 142281173) has the molecular formula C18H28N3O+
and a molecular weight of 302.44 g/mol. Its IUPAC name is ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate.
Molecular Properties
| Compound Name | ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate |
| PubChem CID | 142281173 |
| Molecular Formula | C18H28N3O+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate |
| SMILES | CC.CO/C(=N\c1ccc(C(C)C)cc1)c1n(C)cc[n+]1C |
| InChI | InChI=1S/C16H22N3O.C2H6/c1-12(2)13-6-8-14(9-7-13)17-15(20-5)16-18(3)10-11-19(16)4;1-2/h6-12H,1-5H3;1-2H3/q+1;/b17-15-; |
| InChIKey | UVCCCMFREVIZNJ-NYDCQJDFSA-N |
| XLogP | 3.72 |
| TPSA | 30.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate?
The IUPAC name of ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate (CID 142281173) is ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate.
What is the SMILES notation for ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate?
The canonical SMILES for ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate is CC.CO/C(=N\c1ccc(C(C)C)cc1)c1n(C)cc[n+]1C.
What is the InChIKey of ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate?
The InChIKey is UVCCCMFREVIZNJ-NYDCQJDFSA-N. The full InChI is InChI=1S/C16H22N3O.C2H6/c1-12(2)13-6-8-14(9-7-13)17-15(20-5)16-18(3)10-11-19(16)4;1-2/h6-12H,1-5H3;1-2H3/q+1;/b17-15-;.
What are the key properties of ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate?
ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate has a molecular weight of 302.44 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 1,3-dimethyl-N-(4-propan-2-ylphenyl)imidazol-1-ium-2-carboximidate is sourced from PubChem (CID 142281173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).