C44H54O5 — CID 142281777
[4-methoxy-3-[6-[6-[2-(4-propylcyclohexyl)ethyl]naphthalen-2-yl]naphthalen-2-yl]butyl] 2-(hydroxymethyl)prop-2-enoate;2-methylprop-2-enal (PubChem CID 142281777) has the molecular formula C44H54O5 and a molecular weight of 662.91 g/mol. Its IUPAC name is [4-methoxy-3-[6-[6-[2-(4-propylcyclohexyl)ethyl]naphthalen-2-yl]naphthalen-2-yl]butyl] 2-(hydroxymethyl)prop-2-enoate;2-methylprop-2-enal.
| Compound Name | [4-methoxy-3-[6-[6-[2-(4-propylcyclohexyl)ethyl]naphthalen-2-yl]naphthalen-2-yl]butyl] 2-(hydroxymethyl)prop-2-enoate;2-methylprop-2-enal |
|---|---|
| PubChem CID | 142281777 |
| Molecular Formula | C44H54O5 |
| Molecular Weight | 662.91 g/mol |
| Exact Mass | 662.40 |
| IUPAC Name | [4-methoxy-3-[6-[6-[2-(4-propylcyclohexyl)ethyl]naphthalen-2-yl]naphthalen-2-yl]butyl] 2-(hydroxymethyl)prop-2-enoate;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.C=C(CO)C(=O)OCCC(COC)c1ccc2cc(-c3ccc4cc(CCC5CCC(CCC)CC5)ccc4c3)ccc2c1 |
| InChI | InChI=1S/C40H48O4.C4H6O/c1-4-5-29-6-8-30(9-7-29)10-11-31-12-13-33-23-34(15-14-32(33)22-31)35-16-17-37-25-38(19-18-36(37)24-35)39(27-43-3)20-21-44-40(42)28(2)26-41;1-4(2)3-5/h12-19,22-25,29-30,39,41H,2,4-11,20-21,26-27H2,1,3H3;3H,1H2,2H3 |
| InChIKey | ZNWHFSZIMKUXDC-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.91 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|