C16H6F4N2O4 — CID 14228204
2,3,9,10-tetrafluoro-6,13-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone (PubChem CID 14228204) has the molecular formula C16H6F4N2O4 and a molecular weight of 366.23 g/mol. Its IUPAC name is 2,3,9,10-tetrafluoro-6,13-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone.
| Compound Name | 2,3,9,10-tetrafluoro-6,13-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 14228204 |
| Molecular Formula | C16H6F4N2O4 |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2,3,9,10-tetrafluoro-6,13-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
| SMILES | CN1C(=O)c2c(F)c(F)c3c4c(c(F)c(F)c(c24)C1=O)C(=O)N(C)C3=O |
| InChI | InChI=1S/C16H6F4N2O4/c1-21-13(23)5-3-4-7(11(19)9(5)17)15(25)22(2)16(26)8(4)12(20)10(18)6(3)14(21)24/h1-2H3 |
| InChIKey | AIQNMXBRNRHAPP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|