C21H33FO2 — CID 142282381
2-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-3-methoxypropan-1-ol (PubChem CID 142282381) has the molecular formula C21H33FO2 and a molecular weight of 336.49 g/mol. Its IUPAC name is 2-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-3-methoxypropan-1-ol.
| Compound Name | 2-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 142282381 |
| Molecular Formula | C21H33FO2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 2-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-3-methoxypropan-1-ol |
| SMILES | CCCCCC1CCC(c2ccc(C(CO)COC)c(F)c2)CC1 |
| InChI | InChI=1S/C21H33FO2/c1-3-4-5-6-16-7-9-17(10-8-16)18-11-12-20(21(22)13-18)19(14-23)15-24-2/h11-13,16-17,19,23H,3-10,14-15H2,1-2H3 |
| InChIKey | AZNGQCAGMAFUKE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|