C23H36O — CID 142282504
(3Z,7Z)-4-ethyl-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene (PubChem CID 142282504) has the molecular formula C23H36O and a molecular weight of 328.54 g/mol. Its IUPAC name is (3Z,7Z)-4-ethyl-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene.
| Compound Name | (3Z,7Z)-4-ethyl-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene |
|---|---|
| PubChem CID | 142282504 |
| Molecular Formula | C23H36O |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | (3Z,7Z)-4-ethyl-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene |
| SMILES | C=C(/C=C(/CC)C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)CC)OC |
| InChI | InChI=1S/C23H36O/c1-10-17(3)12-13-18(4)19(5)14-15-20(6)22(8)23(11-2)16-21(7)24-9/h14-18H,5-8,10-13H2,1-4,9H3/b15-14-,23-16- |
| InChIKey | LKWVABHZYMTJGE-GTXPRLNLSA-N |
| XLogP | 7.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|