C21H25FO — CID 142282840
(3Z,7E,11Z)-7-fluoro-2-methoxy-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene (PubChem CID 142282840) has the molecular formula C21H25FO and a molecular weight of 312.43 g/mol. Its IUPAC name is (3Z,7E,11Z)-7-fluoro-2-methoxy-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7E,11Z)-7-fluoro-2-methoxy-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 142282840 |
| Molecular Formula | C21H25FO |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (3Z,7E,11Z)-7-fluoro-2-methoxy-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(\F)C(=C)C(=C)/C=C\C(=C)OC)CC |
| InChI | InChI=1S/C21H25FO/c1-9-15(2)10-11-16(3)18(5)14-21(22)20(7)17(4)12-13-19(6)23-8/h10-14H,2-7,9H2,1,8H3/b11-10-,13-12-,21-14+ |
| InChIKey | JPHYZKJMHRHVTA-UGNVTTIYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|