C28H31N3O2 — CID 14228339
5'-methoxy-1',3',3'-trimethyl-6-piperidin-1-ylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] (PubChem CID 14228339) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 5'-methoxy-1',3',3'-trimethyl-6-piperidin-1-ylspiro[benzo[f][1,4]benzoxazine-3,2'-indole].
| Compound Name | 5'-methoxy-1',3',3'-trimethyl-6-piperidin-1-ylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
|---|---|
| PubChem CID | 14228339 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 5'-methoxy-1',3',3'-trimethyl-6-piperidin-1-ylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
| SMILES | COc1ccc2c(c1)C(C)(C)C1(C=Nc3c(cc(N4CCCCC4)c4ccccc34)O1)N2C |
| InChI | InChI=1S/C28H31N3O2/c1-27(2)22-16-19(32-4)12-13-23(22)30(3)28(27)18-29-26-21-11-7-6-10-20(21)24(17-25(26)33-28)31-14-8-5-9-15-31/h6-7,10-13,16-18H,5,8-9,14-15H2,1-4H3 |
| InChIKey | CNJRLXXIXOGBQA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|