About ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine
ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 142283394) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine.
Molecular Properties
| Compound Name | ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine |
| PubChem CID | 142283394 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC.CN1CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C7H9N3.C2H6/c1-9-6-10-5-3-2-4-7(10)8-9;1-2/h2-5H,6H2,1H3;1-2H3 |
| InChIKey | PFPXGCFEHUMTTI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine?
The IUPAC name of ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine (CID 142283394) is ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine.
What is the SMILES notation for ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine?
The canonical SMILES for ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine is CC.CN1CN2C=CC=CC2=N1.
What is the InChIKey of ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine?
The InChIKey is PFPXGCFEHUMTTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3.C2H6/c1-9-6-10-5-3-2-4-7(10)8-9;1-2/h2-5H,6H2,1H3;1-2H3.
What are the key properties of ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine?
ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine has a molecular weight of 165.24 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-3H-[1,2,4]triazolo[4,3-a]pyridine is sourced from PubChem (CID 142283394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).