C27H29N3O3 — CID 14228340
5'-methoxy-1',3',3'-trimethyl-6-morpholin-4-ylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] (PubChem CID 14228340) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 5'-methoxy-1',3',3'-trimethyl-6-morpholin-4-ylspiro[benzo[f][1,4]benzoxazine-3,2'-indole].
| Compound Name | 5'-methoxy-1',3',3'-trimethyl-6-morpholin-4-ylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
|---|---|
| PubChem CID | 14228340 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 5'-methoxy-1',3',3'-trimethyl-6-morpholin-4-ylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
| SMILES | COc1ccc2c(c1)C(C)(C)C1(C=Nc3c(cc(N4CCOCC4)c4ccccc34)O1)N2C |
| InChI | InChI=1S/C27H29N3O3/c1-26(2)21-15-18(31-4)9-10-22(21)29(3)27(26)17-28-25-20-8-6-5-7-19(20)23(16-24(25)33-27)30-11-13-32-14-12-30/h5-10,15-17H,11-14H2,1-4H3 |
| InChIKey | VYIUIBDVKHQJNA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|