About (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile
(2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile (PubChem CID 142283446) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile |
| PubChem CID | 142283446 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile |
| SMILES | CC/C=C\C(O)=C(/C)C#N |
| InChI | InChI=1S/C8H11NO/c1-3-4-5-8(10)7(2)6-9/h4-5,10H,3H2,1-2H3/b5-4-,8-7- |
| InChIKey | AQKKYCGKUHVKCC-UTOQUPLUSA-N |
| XLogP | 2.31 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile?
The IUPAC name of (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile (CID 142283446) is (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile.
What is the SMILES notation for (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile?
The canonical SMILES for (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile is CC/C=C\C(O)=C(/C)C#N.
What is the InChIKey of (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile?
The InChIKey is AQKKYCGKUHVKCC-UTOQUPLUSA-N. The full InChI is InChI=1S/C8H11NO/c1-3-4-5-8(10)7(2)6-9/h4-5,10H,3H2,1-2H3/b5-4-,8-7-.
What are the key properties of (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile?
(2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile has a molecular weight of 137.18 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-3-hydroxy-2-methylhepta-2,4-dienenitrile is sourced from PubChem (CID 142283446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).