About (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol
(E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol (PubChem CID 142283533) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol.
Molecular Properties
| Compound Name | (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol |
| PubChem CID | 142283533 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol |
| SMILES | C=C/C(CO)=C(\C=C)CC(O)(CC)CCNC |
| InChI | InChI=1S/C14H25NO2/c1-5-12(13(6-2)11-16)10-14(17,7-3)8-9-15-4/h5-6,15-17H,1-2,7-11H2,3-4H3/b13-12- |
| InChIKey | RHOTYECYAHUMRD-SEYXRHQNSA-N |
| XLogP | 1.79 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol?
The IUPAC name of (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol (CID 142283533) is (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol.
What is the SMILES notation for (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol?
The canonical SMILES for (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol is C=C/C(CO)=C(\C=C)CC(O)(CC)CCNC.
What is the InChIKey of (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol?
The InChIKey is RHOTYECYAHUMRD-SEYXRHQNSA-N. The full InChI is InChI=1S/C14H25NO2/c1-5-12(13(6-2)11-16)10-14(17,7-3)8-9-15-4/h5-6,15-17H,1-2,7-11H2,3-4H3/b13-12-.
What are the key properties of (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol?
(E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol has a molecular weight of 239.36 g/mol, XLogP of 1.79, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-bis(ethenyl)-5-ethyl-7-(methylamino)hept-2-ene-1,5-diol is sourced from PubChem (CID 142283533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).