About 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one
3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one (PubChem CID 142283693) has the molecular formula C15H29N3O3
and a molecular weight of 299.42 g/mol. Its IUPAC name is 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one.
Molecular Properties
| Compound Name | 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one |
| PubChem CID | 142283693 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one |
| SMILES | CC(C)CNC1CCC2(CC1)CNC2=O.NC(=O)CCO |
| InChI | InChI=1S/C12H22N2O.C3H7NO2/c1-9(2)7-13-10-3-5-12(6-4-10)8-14-11(12)15;4-3(6)1-2-5/h9-10,13H,3-8H2,1-2H3,(H,14,15);5H,1-2H2,(H2,4,6) |
| InChIKey | FCIUHJFPORMAAB-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one?
The IUPAC name of 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one (CID 142283693) is 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one.
What is the SMILES notation for 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one?
The canonical SMILES for 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one is CC(C)CNC1CCC2(CC1)CNC2=O.NC(=O)CCO.
What is the InChIKey of 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one?
The InChIKey is FCIUHJFPORMAAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O.C3H7NO2/c1-9(2)7-13-10-3-5-12(6-4-10)8-14-11(12)15;4-3(6)1-2-5/h9-10,13H,3-8H2,1-2H3,(H,14,15);5H,1-2H2,(H2,4,6).
What are the key properties of 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one?
3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one has a molecular weight of 299.42 g/mol, XLogP of 0.14, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropanamide;7-(2-methylpropylamino)-2-azaspiro[3.5]nonan-3-one is sourced from PubChem (CID 142283693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).