About 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide
5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide (PubChem CID 142283797) has the molecular formula C11H17N3O2
and a molecular weight of 223.28 g/mol. Its IUPAC name is 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide.
Molecular Properties
| Compound Name | 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide |
| PubChem CID | 142283797 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide |
| SMILES | C=CCCN1C(C(N)=O)CCC12CNC2=O |
| InChI | InChI=1S/C11H17N3O2/c1-2-3-6-14-8(9(12)15)4-5-11(14)7-13-10(11)16/h2,8H,1,3-7H2,(H2,12,15)(H,13,16) |
| InChIKey | NVMSZNHNKLBLDE-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide?
The IUPAC name of 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide (CID 142283797) is 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide.
What is the SMILES notation for 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide?
The canonical SMILES for 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide is C=CCCN1C(C(N)=O)CCC12CNC2=O.
What is the InChIKey of 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide?
The InChIKey is NVMSZNHNKLBLDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2/c1-2-3-6-14-8(9(12)15)4-5-11(14)7-13-10(11)16/h2,8H,1,3-7H2,(H2,12,15)(H,13,16).
What are the key properties of 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide?
5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide has a molecular weight of 223.28 g/mol, XLogP of -0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-enyl-3-oxo-2,5-diazaspiro[3.4]octane-6-carboxamide is sourced from PubChem (CID 142283797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).