About 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane
2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane (PubChem CID 142283871) has the molecular formula C21H20F3N
and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane.
Molecular Properties
| Compound Name | 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane |
| PubChem CID | 142283871 |
| Molecular Formula | C21H20F3N |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane |
| SMILES | C=Cc1ccc2cc(-c3cc(C(F)(F)F)c[nH]3)ccc2c1C=C.CC |
| InChI | InChI=1S/C19H14F3N.C2H6/c1-3-12-5-6-13-9-14(7-8-17(13)16(12)4-2)18-10-15(11-23-18)19(20,21)22;1-2/h3-11,23H,1-2H2;1-2H3 |
| InChIKey | DWAQYNMKRHMLIF-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane?
The IUPAC name of 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane (CID 142283871) is 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane.
What is the SMILES notation for 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane?
The canonical SMILES for 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane is C=Cc1ccc2cc(-c3cc(C(F)(F)F)c[nH]3)ccc2c1C=C.CC.
What is the InChIKey of 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane?
The InChIKey is DWAQYNMKRHMLIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3N.C2H6/c1-3-12-5-6-13-9-14(7-8-17(13)16(12)4-2)18-10-15(11-23-18)19(20,21)22;1-2/h3-11,23H,1-2H2;1-2H3.
What are the key properties of 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane?
2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane has a molecular weight of 343.39 g/mol, XLogP of 7.17, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,6-bis(ethenyl)naphthalen-2-yl]-4-(trifluoromethyl)-1H-pyrrole;ethane is sourced from PubChem (CID 142283871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).