C22H31BO5 — CID 142284190
tert-butyl 2-methoxy-3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate (PubChem CID 142284190) has the molecular formula C22H31BO5 and a molecular weight of 386.30 g/mol. Its IUPAC name is tert-butyl 2-methoxy-3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate.
| Compound Name | tert-butyl 2-methoxy-3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 142284190 |
| Molecular Formula | C22H31BO5 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | tert-butyl 2-methoxy-3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate |
| SMILES | COc1c(B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31BO5/c1-20(2,3)26-19(24)14-9-8-10-15(18(14)25-7)23-27-17-12-13-11-16(21(13,4)5)22(17,6)28-23/h8-10,13,16-17H,11-12H2,1-7H3/t13-,16-,17+,22-/m0/s1 |
| InChIKey | OQEIPAGWKBFUMT-PLKWALTGSA-N |
| XLogP | 3.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|