C32H44O4 — CID 142284351
[2,4-dimethyl-4-[4-[4-(4-propan-2-yloxyphenyl)cyclohexyl]phenoxy]pentan-2-yl] 2-methylprop-2-enoate (PubChem CID 142284351) has the molecular formula C32H44O4 and a molecular weight of 492.70 g/mol. Its IUPAC name is [2,4-dimethyl-4-[4-[4-(4-propan-2-yloxyphenyl)cyclohexyl]phenoxy]pentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2,4-dimethyl-4-[4-[4-(4-propan-2-yloxyphenyl)cyclohexyl]phenoxy]pentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142284351 |
| Molecular Formula | C32H44O4 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | [2,4-dimethyl-4-[4-[4-(4-propan-2-yloxyphenyl)cyclohexyl]phenoxy]pentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CC(C)(C)Oc1ccc(C2CCC(c3ccc(OC(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H44O4/c1-22(2)30(33)36-32(7,8)21-31(5,6)35-29-19-15-27(16-20-29)25-11-9-24(10-12-25)26-13-17-28(18-14-26)34-23(3)4/h13-20,23-25H,1,9-12,21H2,2-8H3 |
| InChIKey | LEFQDUDYOMEPMN-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|