About ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen
ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen (PubChem CID 142284478) has the molecular formula C18H28N2O2
and a molecular weight of 304.43 g/mol. Its IUPAC name is ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen |
| PubChem CID | 142284478 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen |
| SMILES | CC.CC(=O)C1(O)CCC(c2ccc3nn(C)cc3c2)CC1.[H][H] |
| InChI | InChI=1S/C16H20N2O2.C2H6.H2/c1-11(19)16(20)7-5-12(6-8-16)13-3-4-15-14(9-13)10-18(2)17-15;1-2;/h3-4,9-10,12,20H,5-8H2,1-2H3;1-2H3;1H |
| InChIKey | VUWLQXLVKFJFHY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen?
The IUPAC name of ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen (CID 142284478) is ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen.
What is the SMILES notation for ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen?
The canonical SMILES for ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen is CC.CC(=O)C1(O)CCC(c2ccc3nn(C)cc3c2)CC1.[H][H].
What is the InChIKey of ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen?
The InChIKey is VUWLQXLVKFJFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2.C2H6.H2/c1-11(19)16(20)7-5-12(6-8-16)13-3-4-15-14(9-13)10-18(2)17-15;1-2;/h3-4,9-10,12,20H,5-8H2,1-2H3;1-2H3;1H.
What are the key properties of ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen?
ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen has a molecular weight of 304.43 g/mol, XLogP of 3.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[1-hydroxy-4-(2-methylindazol-5-yl)cyclohexyl]ethanone;molecular hydrogen is sourced from PubChem (CID 142284478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).