About (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one
(7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one (PubChem CID 142284492) has the molecular formula C13H17F3O2
and a molecular weight of 262.27 g/mol. Its IUPAC name is (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one.
Molecular Properties
| Compound Name | (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one |
| PubChem CID | 142284492 |
| Molecular Formula | C13H17F3O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)=O)OC(F)(F)F |
| InChI | InChI=1S/C13H17F3O2/c1-9(5-7-11(3)17)10(2)6-8-12(4)18-13(14,15)16/h6,8-9H,2,4-5,7H2,1,3H3/b8-6- |
| InChIKey | FBZLDTOWLXMZLW-VURMDHGXSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one?
The IUPAC name of (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one (CID 142284492) is (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one.
What is the SMILES notation for (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one?
The canonical SMILES for (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one is C=C(/C=C\C(=C)C(C)CCC(C)=O)OC(F)(F)F.
What is the InChIKey of (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one?
The InChIKey is FBZLDTOWLXMZLW-VURMDHGXSA-N. The full InChI is InChI=1S/C13H17F3O2/c1-9(5-7-11(3)17)10(2)6-8-12(4)18-13(14,15)16/h6,8-9H,2,4-5,7H2,1,3H3/b8-6-.
What are the key properties of (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one?
(7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one has a molecular weight of 262.27 g/mol, XLogP of 4.15, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-5-methyl-6-methylidene-9-(trifluoromethoxy)deca-7,9-dien-2-one is sourced from PubChem (CID 142284492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).