C27H30F2N2O — CID 142284538
2-(6-fluoro-8,9-dihydro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[2-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]spiro[3.5]nonan-7-yl]ethanone (PubChem CID 142284538) has the molecular formula C27H30F2N2O and a molecular weight of 436.55 g/mol. Its IUPAC name is 2-(6-fluoro-8,9-dihydro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[2-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]spiro[3.5]nonan-7-yl]ethanone.
| Compound Name | 2-(6-fluoro-8,9-dihydro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[2-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]spiro[3.5]nonan-7-yl]ethanone |
|---|---|
| PubChem CID | 142284538 |
| Molecular Formula | C27H30F2N2O |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 2-(6-fluoro-8,9-dihydro-5H-imidazo[5,1-a]isoindol-5-yl)-1-[2-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]spiro[3.5]nonan-7-yl]ethanone |
| SMILES | C=C/C(F)=C\C=C\C1CC2(CCC(C(=O)CC3C4=C(CCC=C4F)c4cncn43)CC2)C1 |
| InChI | InChI=1S/C27H30F2N2O/c1-2-20(28)6-3-5-18-14-27(15-18)11-9-19(10-12-27)25(32)13-23-26-21(7-4-8-22(26)29)24-16-30-17-31(23)24/h2-3,5-6,8,16-19,23H,1,4,7,9-15H2/b5-3+,20-6+ |
| InChIKey | UVVFPCMNZBMSEQ-XZVSYBBHSA-N |
| XLogP | 6.98 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|