About 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one
2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one (PubChem CID 142284629) has the molecular formula C10H7BrO
and a molecular weight of 223.07 g/mol. Its IUPAC name is 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one.
Molecular Properties
| Compound Name | 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one |
| PubChem CID | 142284629 |
| Molecular Formula | C10H7BrO |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one |
| SMILES | O=C1c2cccc(Br)c2C2CC12 |
| InChI | InChI=1S/C10H7BrO/c11-8-3-1-2-5-9(8)6-4-7(6)10(5)12/h1-3,6-7H,4H2 |
| InChIKey | PZLKGKLADWXNKJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one?
The IUPAC name of 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one (CID 142284629) is 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one.
What is the SMILES notation for 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one?
The canonical SMILES for 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one is O=C1c2cccc(Br)c2C2CC12.
What is the InChIKey of 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one?
The InChIKey is PZLKGKLADWXNKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO/c11-8-3-1-2-5-9(8)6-4-7(6)10(5)12/h1-3,6-7H,4H2.
What are the key properties of 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one?
2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one has a molecular weight of 223.07 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one is sourced from PubChem (CID 142284629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).