C25H31N7O5 — CID 142284799
N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(formamidomethyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide;oxolane (PubChem CID 142284799) has the molecular formula C25H31N7O5 and a molecular weight of 509.57 g/mol. Its IUPAC name is N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(formamidomethyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide;oxolane.
| Compound Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(formamidomethyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide;oxolane |
|---|---|
| PubChem CID | 142284799 |
| Molecular Formula | C25H31N7O5 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(formamidomethyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide;oxolane |
| SMILES | C1CCOC1.COCCNc1cc(NC(=O)N2CCCc3cc(CNC=O)c(C=O)nc32)ncc1C#N |
| InChI | InChI=1S/C21H23N7O4.C4H8O/c1-32-6-4-24-17-8-19(25-11-16(17)9-22)27-21(31)28-5-2-3-14-7-15(10-23-13-30)18(12-29)26-20(14)28;1-2-4-5-3-1/h7-8,11-13H,2-6,10H2,1H3,(H,23,30)(H2,24,25,27,31);1-4H2 |
| InChIKey | SEKVIWWPQFMJGL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 158.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|