About 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane
3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane (PubChem CID 142285345) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane.
Molecular Properties
| Compound Name | 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane |
| PubChem CID | 142285345 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane |
| SMILES | CC.CC.Cc1cc2cn(C)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C8H9N3O.2C2H6/c1-5-3-6-4-11(2)8(12)10-7(6)9-5;2*1-2/h3-4H,1-2H3,(H,9,10,12);2*1-2H3 |
| InChIKey | FMKWVCCRZLPRHF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane?
The IUPAC name of 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane (CID 142285345) is 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane.
What is the SMILES notation for 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane?
The canonical SMILES for 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane is CC.CC.Cc1cc2cn(C)c(=O)nc2[nH]1.
What is the InChIKey of 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane?
The InChIKey is FMKWVCCRZLPRHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O.2C2H6/c1-5-3-6-4-11(2)8(12)10-7(6)9-5;2*1-2/h3-4H,1-2H3,(H,9,10,12);2*1-2H3.
What are the key properties of 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane?
3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane has a molecular weight of 223.32 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-2-one;ethane is sourced from PubChem (CID 142285345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).