C36H56O2 — CID 142285463
9-[1-(2,3-dimethylcyclobutyl)ethenoxy]-3a-ethyl-8,11a-dimethyl-1-propan-2-yl-3,4,5,5a,5b,6,7,7a,8,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-2-one (PubChem CID 142285463) has the molecular formula C36H56O2 and a molecular weight of 520.84 g/mol. Its IUPAC name is 9-[1-(2,3-dimethylcyclobutyl)ethenoxy]-3a-ethyl-8,11a-dimethyl-1-propan-2-yl-3,4,5,5a,5b,6,7,7a,8,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-2-one.
| Compound Name | 9-[1-(2,3-dimethylcyclobutyl)ethenoxy]-3a-ethyl-8,11a-dimethyl-1-propan-2-yl-3,4,5,5a,5b,6,7,7a,8,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-2-one |
|---|---|
| PubChem CID | 142285463 |
| Molecular Formula | C36H56O2 |
| Molecular Weight | 520.84 g/mol |
| Exact Mass | 520.43 |
| IUPAC Name | 9-[1-(2,3-dimethylcyclobutyl)ethenoxy]-3a-ethyl-8,11a-dimethyl-1-propan-2-yl-3,4,5,5a,5b,6,7,7a,8,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-2-one |
| SMILES | C=C(OC1CCC2(C)C(CCC3C4CCC5(CC)CC(=O)C(C(C)C)=C5C4CCC32)C1C)C1CC(C)C1C |
| InChI | InChI=1S/C36H56O2/c1-9-36-17-14-25-26-10-12-29-23(6)32(38-24(7)28-18-21(4)22(28)5)15-16-35(29,8)30(26)13-11-27(25)34(36)33(20(2)3)31(37)19-36/h20-23,25-30,32H,7,9-19H2,1-6,8H3 |
| InChIKey | RSPDXXHFXMZNSP-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.84 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|