C49H42F6O10 — CID 142285755
[4-[(E)-3-oxo-3-[2-phenyl-3-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxypropoxy]prop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 142285755) has the molecular formula C49H42F6O10 and a molecular weight of 904.85 g/mol. Its IUPAC name is [4-[(E)-3-oxo-3-[2-phenyl-3-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxypropoxy]prop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | [4-[(E)-3-oxo-3-[2-phenyl-3-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxypropoxy]prop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 142285755 |
| Molecular Formula | C49H42F6O10 |
| Molecular Weight | 904.85 g/mol |
| Exact Mass | 904.27 |
| IUPAC Name | [4-[(E)-3-oxo-3-[2-phenyl-3-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoyl]oxypropoxy]prop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | O=C(/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)F)cc2)cc1)OCC(COC(=O)/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)F)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C49H42F6O10/c50-48(51,52)28-4-30-60-40-22-14-37(15-23-40)46(58)64-42-18-8-34(9-19-42)12-26-44(56)62-32-39(36-6-2-1-3-7-36)33-63-45(57)27-13-35-10-20-43(21-11-35)65-47(59)38-16-24-41(25-17-38)61-31-5-29-49(53,54)55/h1-3,6-27,39H,4-5,28-33H2/b26-12+,27-13+ |
| InChIKey | QETIYMCHQRFKKU-JCAXBWHZSA-N |
| XLogP | 11.16 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.85 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|