About 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene]
1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene] (PubChem CID 142285902) has the molecular formula C27H30O5S
and a molecular weight of 466.60 g/mol. Its IUPAC name is 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene].
Molecular Properties
| Compound Name | 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene] |
| PubChem CID | 142285902 |
| Molecular Formula | C27H30O5S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene] |
| SMILES | COc1ccc2c(c1)C1(OCCO1)c1ccccc1S2.O=COC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H14O3S.C11H16O2/c1-17-11-6-7-15-13(10-11)16(18-8-9-19-16)12-4-2-3-5-14(12)20-15;12-7-13-11-4-8-1-9(5-11)3-10(2-8)6-11/h2-7,10H,8-9H2,1H3;7-10H,1-6H2 |
| InChIKey | PGGVHKORXWAPBC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene]?
The IUPAC name of 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene] (CID 142285902) is 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene].
What is the SMILES notation for 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene]?
The canonical SMILES for 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene] is COc1ccc2c(c1)C1(OCCO1)c1ccccc1S2.O=COC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene]?
The InChIKey is PGGVHKORXWAPBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3S.C11H16O2/c1-17-11-6-7-15-13(10-11)16(18-8-9-19-16)12-4-2-3-5-14(12)20-15;12-7-13-11-4-8-1-9(5-11)3-10(2-8)6-11/h2-7,10H,8-9H2,1H3;7-10H,1-6H2.
What are the key properties of 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene]?
1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene] has a molecular weight of 466.60 g/mol, XLogP of 5.54, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl formate;2'-methoxyspiro[1,3-dioxolane-2,9'-thioxanthene] is sourced from PubChem (CID 142285902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).