C54H59N3O9 — CID 142285907
2'-methoxy-10'-methylspiro[1,3-dioxane-2,9'-acridine];2'-methoxy-10'-methylspiro[1,3-dioxepane-2,9'-acridine];2,9,9-trimethoxy-10-methylacridine (PubChem CID 142285907) has the molecular formula C54H59N3O9 and a molecular weight of 894.08 g/mol. Its IUPAC name is 2'-methoxy-10'-methylspiro[1,3-dioxane-2,9'-acridine];2'-methoxy-10'-methylspiro[1,3-dioxepane-2,9'-acridine];2,9,9-trimethoxy-10-methylacridine.
| Compound Name | 2'-methoxy-10'-methylspiro[1,3-dioxane-2,9'-acridine];2'-methoxy-10'-methylspiro[1,3-dioxepane-2,9'-acridine];2,9,9-trimethoxy-10-methylacridine |
|---|---|
| PubChem CID | 142285907 |
| Molecular Formula | C54H59N3O9 |
| Molecular Weight | 894.08 g/mol |
| Exact Mass | 893.43 |
| IUPAC Name | 2'-methoxy-10'-methylspiro[1,3-dioxane-2,9'-acridine];2'-methoxy-10'-methylspiro[1,3-dioxepane-2,9'-acridine];2,9,9-trimethoxy-10-methylacridine |
| SMILES | COc1ccc2c(c1)C(OC)(OC)c1ccccc1N2C.COc1ccc2c(c1)C1(OCCCCO1)c1ccccc1N2C.COc1ccc2c(c1)C1(OCCCO1)c1ccccc1N2C |
| InChI | InChI=1S/C19H21NO3.C18H19NO3.C17H19NO3/c1-20-17-8-4-3-7-15(17)19(22-11-5-6-12-23-19)16-13-14(21-2)9-10-18(16)20;1-19-16-7-4-3-6-14(16)18(21-10-5-11-22-18)15-12-13(20-2)8-9-17(15)19;1-18-15-8-6-5-7-13(15)17(20-3,21-4)14-11-12(19-2)9-10-16(14)18/h3-4,7-10,13H,5-6,11-12H2,1-2H3;3-4,6-9,12H,5,10-11H2,1-2H3;5-11H,1-4H3 |
| InChIKey | BGFIBCIEGONIBD-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 92.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.08 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|